C12H26N6O6Zn — CID 166523784
bis((2S)-2-amino-5-(carbamoylamino)pentanoic acid);zinc (PubChem CID 166523784) has the molecular formula C12H26N6O6Zn and a molecular weight of 415.77 g/mol. Its IUPAC name is bis((2S)-2-amino-5-(carbamoylamino)pentanoic acid);zinc.
| Compound Name | bis((2S)-2-amino-5-(carbamoylamino)pentanoic acid);zinc |
|---|---|
| PubChem CID | 166523784 |
| Molecular Formula | C12H26N6O6Zn |
| Molecular Weight | 415.77 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | bis((2S)-2-amino-5-(carbamoylamino)pentanoic acid);zinc |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)O.NC(=O)NCCC[C@H](N)C(=O)O.[Zn] |
| InChI | InChI=1S/2C6H13N3O3.Zn/c2*7-4(5(10)11)2-1-3-9-6(8)12;/h2*4H,1-3,7H2,(H,10,11)(H3,8,9,12);/t2*4-;/m00./s1 |
| InChIKey | MTFNOYMJCRARPO-SCGRZTRASA-N |
| XLogP | -2.31 |
| TPSA | 236.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.77 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|