C16H32N6O11 — CID 46189968
bis(2-amino-5-(carbamoylamino)pentanoic acid);2-hydroxybutanedioic acid (PubChem CID 46189968) has the molecular formula C16H32N6O11 and a molecular weight of 484.46 g/mol. Its IUPAC name is bis(2-amino-5-(carbamoylamino)pentanoic acid);2-hydroxybutanedioic acid.
| Compound Name | bis(2-amino-5-(carbamoylamino)pentanoic acid);2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 46189968 |
| Molecular Formula | C16H32N6O11 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | bis(2-amino-5-(carbamoylamino)pentanoic acid);2-hydroxybutanedioic acid |
| SMILES | NC(=O)NCCCC(N)C(=O)O.NC(=O)NCCCC(N)C(=O)O.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/2C6H13N3O3.C4H6O5/c2*7-4(5(10)11)2-1-3-9-6(8)12;5-2(4(8)9)1-3(6)7/h2*4H,1-3,7H2,(H,10,11)(H3,8,9,12);2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | JBSOAEVZONJKCE-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 331.71 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|