C13H22N4O7 — CID 89042288
2-[3-[[2-amino-5-(carbamoylamino)pentanoyl]amino]-2-oxopropyl]butanedioic acid (PubChem CID 89042288) has the molecular formula C13H22N4O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[3-[[2-amino-5-(carbamoylamino)pentanoyl]amino]-2-oxopropyl]butanedioic acid.
| Compound Name | 2-[3-[[2-amino-5-(carbamoylamino)pentanoyl]amino]-2-oxopropyl]butanedioic acid |
|---|---|
| PubChem CID | 89042288 |
| Molecular Formula | C13H22N4O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[3-[[2-amino-5-(carbamoylamino)pentanoyl]amino]-2-oxopropyl]butanedioic acid |
| SMILES | NC(=O)NCCCC(N)C(=O)NCC(=O)CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H22N4O7/c14-9(2-1-3-16-13(15)24)11(21)17-6-8(18)4-7(12(22)23)5-10(19)20/h7,9H,1-6,14H2,(H,17,21)(H,19,20)(H,22,23)(H3,15,16,24) |
| InChIKey | YRTNVBWQQJIQIZ-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 201.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|