C16H23N3O4 — CID 146157203
5-amino-2-benzyl-8-(carbamoylamino)-4-oxooctanoic acid (PubChem CID 146157203) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-amino-2-benzyl-8-(carbamoylamino)-4-oxooctanoic acid.
| Compound Name | 5-amino-2-benzyl-8-(carbamoylamino)-4-oxooctanoic acid |
|---|---|
| PubChem CID | 146157203 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 5-amino-2-benzyl-8-(carbamoylamino)-4-oxooctanoic acid |
| SMILES | NC(=O)NCCCC(N)C(=O)CC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H23N3O4/c17-13(7-4-8-19-16(18)23)14(20)10-12(15(21)22)9-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10,17H2,(H,21,22)(H3,18,19,23) |
| InChIKey | AEQUVHJBNRTATA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|