C24H39N3O3 — CID 165082503
2-benzyl-N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-4,4-dimethylpentanamide (PubChem CID 165082503) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is 2-benzyl-N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-4,4-dimethylpentanamide.
| Compound Name | 2-benzyl-N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 165082503 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 2-benzyl-N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(Cc1ccccc1)C(=O)NC(CCCNC(N)=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H39N3O3/c1-23(2,3)16-18(15-17-11-8-7-9-12-17)21(29)27-19(20(28)24(4,5)6)13-10-14-26-22(25)30/h7-9,11-12,18-19H,10,13-16H2,1-6H3,(H,27,29)(H3,25,26,30) |
| InChIKey | NGPRFOXQSFFAAE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|