C20H33NO — CID 167585610
(2R)-2-benzyl-N-(3,3-dimethylbutyl)-4,4-dimethylpentanamide (PubChem CID 167585610) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is (2R)-2-benzyl-N-(3,3-dimethylbutyl)-4,4-dimethylpentanamide.
| Compound Name | (2R)-2-benzyl-N-(3,3-dimethylbutyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 167585610 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | (2R)-2-benzyl-N-(3,3-dimethylbutyl)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCNC(=O)[C@@H](Cc1ccccc1)CC(C)(C)C |
| InChI | InChI=1S/C20H33NO/c1-19(2,3)12-13-21-18(22)17(15-20(4,5)6)14-16-10-8-7-9-11-16/h7-11,17H,12-15H2,1-6H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | CTYCTKBBQGAPHF-KRWDZBQOSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |