C24H32O — CID 163649343
(4S)-2,2,6,6-tetramethyl-4-[(4-phenylphenyl)methyl]heptan-3-one (PubChem CID 163649343) has the molecular formula C24H32O and a molecular weight of 336.52 g/mol. Its IUPAC name is (4S)-2,2,6,6-tetramethyl-4-[(4-phenylphenyl)methyl]heptan-3-one.
| Compound Name | (4S)-2,2,6,6-tetramethyl-4-[(4-phenylphenyl)methyl]heptan-3-one |
|---|---|
| PubChem CID | 163649343 |
| Molecular Formula | C24H32O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (4S)-2,2,6,6-tetramethyl-4-[(4-phenylphenyl)methyl]heptan-3-one |
| SMILES | CC(C)(C)C[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H32O/c1-23(2,3)17-21(22(25)24(4,5)6)16-18-12-14-20(15-13-18)19-10-8-7-9-11-19/h7-15,21H,16-17H2,1-6H3/t21-/m1/s1 |
| InChIKey | BHHAFPHBOSWQND-OAQYLSRUSA-N |
| XLogP | 6.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |