C16H17NO2 — CID 29061373
(2S)-2-(azaniumylmethyl)-3-(4-phenylphenyl)propanoate (PubChem CID 29061373) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (2S)-2-(azaniumylmethyl)-3-(4-phenylphenyl)propanoate.
| Compound Name | (2S)-2-(azaniumylmethyl)-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 29061373 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (2S)-2-(azaniumylmethyl)-3-(4-phenylphenyl)propanoate |
| SMILES | [NH3+]C[C@H](Cc1ccc(-c2ccccc2)cc1)C(=O)[O-] |
| InChI | InChI=1S/C16H17NO2/c17-11-15(16(18)19)10-12-6-8-14(9-7-12)13-4-2-1-3-5-13/h1-9,15H,10-11,17H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | LGXCBYBDNGJBSO-HNNXBMFYSA-N |
| XLogP | 0.50 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |