C18H20NO4P-2 — CID 176862423
(2S)-2-[[[(1R)-1-aminoethyl]-oxidophosphoryl]methyl]-3-(4-phenylphenyl)propanoate (PubChem CID 176862423) has the molecular formula C18H20NO4P-2 and a molecular weight of 345.34 g/mol. Its IUPAC name is (2S)-2-[[[(1R)-1-aminoethyl]-oxidophosphoryl]methyl]-3-(4-phenylphenyl)propanoate.
| Compound Name | (2S)-2-[[[(1R)-1-aminoethyl]-oxidophosphoryl]methyl]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 176862423 |
| Molecular Formula | C18H20NO4P-2 |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2S)-2-[[[(1R)-1-aminoethyl]-oxidophosphoryl]methyl]-3-(4-phenylphenyl)propanoate |
| SMILES | C[C@H](N)P(=O)([O-])C[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)[O-] |
| InChI | InChI=1S/C18H22NO4P/c1-13(19)24(22,23)12-17(18(20)21)11-14-7-9-16(10-8-14)15-5-3-2-4-6-15/h2-10,13,17H,11-12,19H2,1H3,(H,20,21)(H,22,23)/p-2/t13-,17-/m1/s1 |
| InChIKey | RULOQVYHCOJDKE-CXAGYDPISA-L |
| XLogP | 1.21 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|