C18H21O4P — CID 90197101
2-[[ethyl(hydroxy)phosphoryl]methyl]-3-(4-phenylphenyl)propanoic acid (PubChem CID 90197101) has the molecular formula C18H21O4P and a molecular weight of 332.34 g/mol. Its IUPAC name is 2-[[ethyl(hydroxy)phosphoryl]methyl]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 2-[[ethyl(hydroxy)phosphoryl]methyl]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 90197101 |
| Molecular Formula | C18H21O4P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[[ethyl(hydroxy)phosphoryl]methyl]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CCP(=O)(O)CC(Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C18H21O4P/c1-2-23(21,22)13-17(18(19)20)12-14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-11,17H,2,12-13H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | ZACROIAPTKKNEF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|