C34H36NO6P — CID 18668669
[3-ethoxy-3-oxo-2-[(4-phenylphenyl)methyl]propyl]-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid (PubChem CID 18668669) has the molecular formula C34H36NO6P and a molecular weight of 585.64 g/mol. Its IUPAC name is [3-ethoxy-3-oxo-2-[(4-phenylphenyl)methyl]propyl]-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid.
| Compound Name | [3-ethoxy-3-oxo-2-[(4-phenylphenyl)methyl]propyl]-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid |
|---|---|
| PubChem CID | 18668669 |
| Molecular Formula | C34H36NO6P |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | [3-ethoxy-3-oxo-2-[(4-phenylphenyl)methyl]propyl]-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid |
| SMILES | CCOC(=O)C(Cc1ccc(-c2ccccc2)cc1)CP(=O)(O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H36NO6P/c1-2-40-33(36)31(22-27-18-20-30(21-19-27)29-16-10-5-11-17-29)25-42(38,39)32(23-26-12-6-3-7-13-26)35-34(37)41-24-28-14-8-4-9-15-28/h3-21,31-32H,2,22-25H2,1H3,(H,35,37)(H,38,39) |
| InChIKey | DTCIQMYSHIQYAB-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|