C20H26NO5P — CID 174817129
butoxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid (PubChem CID 174817129) has the molecular formula C20H26NO5P and a molecular weight of 391.40 g/mol. Its IUPAC name is butoxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid.
| Compound Name | butoxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid |
|---|---|
| PubChem CID | 174817129 |
| Molecular Formula | C20H26NO5P |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | butoxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid |
| SMILES | CCCCOP(=O)(O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26NO5P/c1-2-3-14-26-27(23,24)19(15-17-10-6-4-7-11-17)21-20(22)25-16-18-12-8-5-9-13-18/h4-13,19H,2-3,14-16H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | GNROMDNGKSLIJI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|