C32H40NO6P — CID 101443831
tert-butyl (2S)-2-benzyl-3-[ethoxy-[(1R)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoate (PubChem CID 101443831) has the molecular formula C32H40NO6P and a molecular weight of 565.65 g/mol. Its IUPAC name is tert-butyl (2S)-2-benzyl-3-[ethoxy-[(1R)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoate.
| Compound Name | tert-butyl (2S)-2-benzyl-3-[ethoxy-[(1R)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoate |
|---|---|
| PubChem CID | 101443831 |
| Molecular Formula | C32H40NO6P |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | tert-butyl (2S)-2-benzyl-3-[ethoxy-[(1R)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoate |
| SMILES | CCOP(=O)(C[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H40NO6P/c1-5-38-40(36,24-28(30(34)39-32(2,3)4)21-25-15-9-6-10-16-25)29(22-26-17-11-7-12-18-26)33-31(35)37-23-27-19-13-8-14-20-27/h6-20,28-29H,5,21-24H2,1-4H3,(H,33,35)/t28-,29-,40?/m1/s1 |
| InChIKey | FYJVHOMLAIXTLS-IMVCMCQESA-N |
| XLogP | 7.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|