C28H32NO6P — CID 24828441
[(2S)-2-benzyl-3-ethoxy-3-oxopropyl]-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid (PubChem CID 24828441) has the molecular formula C28H32NO6P and a molecular weight of 509.54 g/mol. Its IUPAC name is [(2S)-2-benzyl-3-ethoxy-3-oxopropyl]-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid.
| Compound Name | [(2S)-2-benzyl-3-ethoxy-3-oxopropyl]-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid |
|---|---|
| PubChem CID | 24828441 |
| Molecular Formula | C28H32NO6P |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | [(2S)-2-benzyl-3-ethoxy-3-oxopropyl]-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)CP(=O)(O)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H32NO6P/c1-2-34-27(30)25(18-22-12-6-3-7-13-22)21-36(32,33)26(19-23-14-8-4-9-15-23)29-28(31)35-20-24-16-10-5-11-17-24/h3-17,25-26H,2,18-21H2,1H3,(H,29,31)(H,32,33)/t25-,26+/m1/s1 |
| InChIKey | LUOUDQMQRPBBQP-FTJBHMTQSA-N |
| XLogP | 5.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|