C20H24NO5P — CID 11406618
(2R)-2-[[(1-acetamido-2-phenylethyl)-hydroxyphosphoryl]methyl]-3-phenylpropanoic acid (PubChem CID 11406618) has the molecular formula C20H24NO5P and a molecular weight of 389.39 g/mol. Its IUPAC name is (2R)-2-[[(1-acetamido-2-phenylethyl)-hydroxyphosphoryl]methyl]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(1-acetamido-2-phenylethyl)-hydroxyphosphoryl]methyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11406618 |
| Molecular Formula | C20H24NO5P |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (2R)-2-[[(1-acetamido-2-phenylethyl)-hydroxyphosphoryl]methyl]-3-phenylpropanoic acid |
| SMILES | CC(=O)NC(Cc1ccccc1)P(=O)(O)C[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H24NO5P/c1-15(22)21-19(13-17-10-6-3-7-11-17)27(25,26)14-18(20(23)24)12-16-8-4-2-5-9-16/h2-11,18-19H,12-14H2,1H3,(H,21,22)(H,23,24)(H,25,26)/t18-,19?/m0/s1 |
| InChIKey | RTRJYVQSFZYBNF-OYKVQYDMSA-N |
| XLogP | 2.91 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|