C20H21BrNO6P — CID 67153169
2-[(4-bromophenyl)methyl]-3-[hydroxy-[1-[(2-oxo-2-phenylacetyl)amino]ethyl]phosphoryl]propanoic acid (PubChem CID 67153169) has the molecular formula C20H21BrNO6P and a molecular weight of 482.27 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-3-[hydroxy-[1-[(2-oxo-2-phenylacetyl)amino]ethyl]phosphoryl]propanoic acid.
| Compound Name | 2-[(4-bromophenyl)methyl]-3-[hydroxy-[1-[(2-oxo-2-phenylacetyl)amino]ethyl]phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 67153169 |
| Molecular Formula | C20H21BrNO6P |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-3-[hydroxy-[1-[(2-oxo-2-phenylacetyl)amino]ethyl]phosphoryl]propanoic acid |
| SMILES | CC(NC(=O)C(=O)c1ccccc1)P(=O)(O)CC(Cc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C20H21BrNO6P/c1-13(22-19(24)18(23)15-5-3-2-4-6-15)29(27,28)12-16(20(25)26)11-14-7-9-17(21)10-8-14/h2-10,13,16H,11-12H2,1H3,(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | KTLSGBZZIYVPLS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|