C16H21BrO3 — CID 74223550
2-[(4-bromophenyl)methyl]-5-ethyl-4-oxoheptanoic acid (PubChem CID 74223550) has the molecular formula C16H21BrO3 and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-5-ethyl-4-oxoheptanoic acid.
| Compound Name | 2-[(4-bromophenyl)methyl]-5-ethyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 74223550 |
| Molecular Formula | C16H21BrO3 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-5-ethyl-4-oxoheptanoic acid |
| SMILES | CCC(CC)C(=O)CC(Cc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C16H21BrO3/c1-3-12(4-2)15(18)10-13(16(19)20)9-11-5-7-14(17)8-6-11/h5-8,12-13H,3-4,9-10H2,1-2H3,(H,19,20) |
| InChIKey | XFDYJKGUCVCRFI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |