C18H18BrNO3 — CID 1112955
(2R)-4-(benzylamino)-2-[(4-bromophenyl)methyl]-4-oxobutanoic acid (PubChem CID 1112955) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is (2R)-4-(benzylamino)-2-[(4-bromophenyl)methyl]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(benzylamino)-2-[(4-bromophenyl)methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 1112955 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (2R)-4-(benzylamino)-2-[(4-bromophenyl)methyl]-4-oxobutanoic acid |
| SMILES | O=C(C[C@@H](Cc1ccc(Br)cc1)C(=O)O)NCc1ccccc1 |
| InChI | InChI=1S/C18H18BrNO3/c19-16-8-6-13(7-9-16)10-15(18(22)23)11-17(21)20-12-14-4-2-1-3-5-14/h1-9,15H,10-12H2,(H,20,21)(H,22,23)/t15-/m1/s1 |
| InChIKey | JGKOYXHYXWPGNN-OAHLLOKOSA-N |
| XLogP | 3.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |