C27H29N3O4 — CID 74996200
2-benzyl-N-[1-(benzylamino)-1-oxo-3-phenylpropan-2-yl]-N'-hydroxybutanediamide (PubChem CID 74996200) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-benzyl-N-[1-(benzylamino)-1-oxo-3-phenylpropan-2-yl]-N'-hydroxybutanediamide.
| Compound Name | 2-benzyl-N-[1-(benzylamino)-1-oxo-3-phenylpropan-2-yl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 74996200 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-benzyl-N-[1-(benzylamino)-1-oxo-3-phenylpropan-2-yl]-N'-hydroxybutanediamide |
| SMILES | O=C(CC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NCc1ccccc1)NO |
| InChI | InChI=1S/C27H29N3O4/c31-25(30-34)18-23(16-20-10-4-1-5-11-20)26(32)29-24(17-21-12-6-2-7-13-21)27(33)28-19-22-14-8-3-9-15-22/h1-15,23-24,34H,16-19H2,(H,28,33)(H,29,32)(H,30,31) |
| InChIKey | QLLHBFHVPQQFRB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|