C24H31N3O6 — CID 18395280
(2R)-2-[2-(4-ethoxyphenoxy)ethyl]-N'-hydroxy-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanediamide (PubChem CID 18395280) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is (2R)-2-[2-(4-ethoxyphenoxy)ethyl]-N'-hydroxy-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanediamide.
| Compound Name | (2R)-2-[2-(4-ethoxyphenoxy)ethyl]-N'-hydroxy-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanediamide |
|---|---|
| PubChem CID | 18395280 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (2R)-2-[2-(4-ethoxyphenoxy)ethyl]-N'-hydroxy-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanediamide |
| SMILES | CCOc1ccc(OCC[C@H](CC(=O)NO)C(=O)N[C@@H](Cc2ccccc2)C(=O)NC)cc1 |
| InChI | InChI=1S/C24H31N3O6/c1-3-32-19-9-11-20(12-10-19)33-14-13-18(16-22(28)27-31)23(29)26-21(24(30)25-2)15-17-7-5-4-6-8-17/h4-12,18,21,31H,3,13-16H2,1-2H3,(H,25,30)(H,26,29)(H,27,28)/t18-,21+/m1/s1 |
| InChIKey | PRNVLAWSOWOYLJ-NQIIRXRSSA-N |
| XLogP | 1.84 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|