C25H33N3O6 — CID 18395283
(2R)-2-[3-(4-ethoxyphenoxy)propyl]-N'-hydroxy-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanediamide (PubChem CID 18395283) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is (2R)-2-[3-(4-ethoxyphenoxy)propyl]-N'-hydroxy-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanediamide.
| Compound Name | (2R)-2-[3-(4-ethoxyphenoxy)propyl]-N'-hydroxy-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanediamide |
|---|---|
| PubChem CID | 18395283 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (2R)-2-[3-(4-ethoxyphenoxy)propyl]-N'-hydroxy-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanediamide |
| SMILES | CCOc1ccc(OCCC[C@H](CC(=O)NO)C(=O)N[C@@H](Cc2ccccc2)C(=O)NC)cc1 |
| InChI | InChI=1S/C25H33N3O6/c1-3-33-20-11-13-21(14-12-20)34-15-7-10-19(17-23(29)28-32)24(30)27-22(25(31)26-2)16-18-8-5-4-6-9-18/h4-6,8-9,11-14,19,22,32H,3,7,10,15-17H2,1-2H3,(H,26,31)(H,27,30)(H,28,29)/t19-,22+/m1/s1 |
| InChIKey | WLROIMNTYCNHMZ-KNQAVFIVSA-N |
| XLogP | 2.23 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|