C22H33N3O5 — CID 22871761
(3R)-3-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]-7-(4-oxobutylamino)heptanoic acid (PubChem CID 22871761) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is (3R)-3-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]-7-(4-oxobutylamino)heptanoic acid.
| Compound Name | (3R)-3-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]-7-(4-oxobutylamino)heptanoic acid |
|---|---|
| PubChem CID | 22871761 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (3R)-3-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]-7-(4-oxobutylamino)heptanoic acid |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCNCCCC=O)CC(=O)O |
| InChI | InChI=1S/C22H33N3O5/c1-23-22(30)19(15-17-9-3-2-4-10-17)25-21(29)18(16-20(27)28)11-5-6-12-24-13-7-8-14-26/h2-4,9-10,14,18-19,24H,5-8,11-13,15-16H2,1H3,(H,23,30)(H,25,29)(H,27,28)/t18-,19+/m1/s1 |
| InChIKey | XWXVWPQIDLBHIA-MOPGFXCFSA-N |
| XLogP | 1.29 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|