C22H29N3O4 — CID 87854664
N'-hydroxy-N-[(2S)-1-(methylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide (PubChem CID 87854664) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N'-hydroxy-N-[(2S)-1-(methylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide.
| Compound Name | N'-hydroxy-N-[(2S)-1-(methylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 87854664 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N'-hydroxy-N-[(2S)-1-(methylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)C(CC(=O)NO)CC(C)C |
| InChI | InChI=1S/C22H29N3O4/c1-14(2)10-18(13-20(26)25-29)21(27)24-19(22(28)23-3)12-15-8-9-16-6-4-5-7-17(16)11-15/h4-9,11,14,18-19,29H,10,12-13H2,1-3H3,(H,23,28)(H,24,27)(H,25,26)/t18?,19-/m0/s1 |
| InChIKey | USFNQSYWKLKGHX-GGYWPGCISA-N |
| XLogP | 2.17 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|