C25H27N3O5 — CID 74999760
N,2-dihydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-(naphthalen-2-ylmethyl)butanediamide (PubChem CID 74999760) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is N,2-dihydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-(naphthalen-2-ylmethyl)butanediamide.
| Compound Name | N,2-dihydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-(naphthalen-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 74999760 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N,2-dihydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-(naphthalen-2-ylmethyl)butanediamide |
| SMILES | CNC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccc2ccccc2c1)C(O)C(=O)NO |
| InChI | InChI=1S/C25H27N3O5/c1-26-24(31)21(15-16-7-3-2-4-8-16)27-23(30)20(22(29)25(32)28-33)14-17-11-12-18-9-5-6-10-19(18)13-17/h2-13,20-22,29,33H,14-15H2,1H3,(H,26,31)(H,27,30)(H,28,32) |
| InChIKey | SXOXCZACGQUJNW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|