C21H25N3O5 — CID 123949809
N-(1-amino-1-oxo-3-phenylpropan-2-yl)-N',3-dihydroxy-2-[(4-methylphenyl)methyl]butanediamide (PubChem CID 123949809) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-(1-amino-1-oxo-3-phenylpropan-2-yl)-N',3-dihydroxy-2-[(4-methylphenyl)methyl]butanediamide.
| Compound Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-N',3-dihydroxy-2-[(4-methylphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 123949809 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-N',3-dihydroxy-2-[(4-methylphenyl)methyl]butanediamide |
| SMILES | Cc1ccc(CC(C(=O)NC(Cc2ccccc2)C(N)=O)C(O)C(=O)NO)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-13-7-9-15(10-8-13)11-16(18(25)21(28)24-29)20(27)23-17(19(22)26)12-14-5-3-2-4-6-14/h2-10,16-18,25,29H,11-12H2,1H3,(H2,22,26)(H,23,27)(H,24,28) |
| InChIKey | AAQSLWAXGIEMIW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|