C21H25N4O6- — CID 163545836
N,2-dihydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-[[4-(oxidoamino)phenyl]methyl]butanediamide (PubChem CID 163545836) has the molecular formula C21H25N4O6- and a molecular weight of 429.45 g/mol. Its IUPAC name is N,2-dihydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-[[4-(oxidoamino)phenyl]methyl]butanediamide.
| Compound Name | N,2-dihydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-[[4-(oxidoamino)phenyl]methyl]butanediamide |
|---|---|
| PubChem CID | 163545836 |
| Molecular Formula | C21H25N4O6- |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N,2-dihydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-[[4-(oxidoamino)phenyl]methyl]butanediamide |
| SMILES | CNC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccc(N[O-])cc1)C(O)C(=O)NO |
| InChI | InChI=1S/C21H25N4O6/c1-22-20(28)17(12-13-5-3-2-4-6-13)23-19(27)16(18(26)21(29)25-31)11-14-7-9-15(24-30)10-8-14/h2-10,16-18,24,26,31H,11-12H2,1H3,(H,22,28)(H,23,27)(H,25,29)/q-1 |
| InChIKey | FMUZIFOESQMXBJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|