C26H35N3O4S — CID 142263237
(2S,3R)-N-hydroxy-N'-[(2S)-1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]-3-(2-methylpropyl)-2-(phenylsulfanylmethyl)butanediamide (PubChem CID 142263237) has the molecular formula C26H35N3O4S and a molecular weight of 485.65 g/mol. Its IUPAC name is (2S,3R)-N-hydroxy-N'-[(2S)-1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]-3-(2-methylpropyl)-2-(phenylsulfanylmethyl)butanediamide.
| Compound Name | (2S,3R)-N-hydroxy-N'-[(2S)-1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]-3-(2-methylpropyl)-2-(phenylsulfanylmethyl)butanediamide |
|---|---|
| PubChem CID | 142263237 |
| Molecular Formula | C26H35N3O4S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | (2S,3R)-N-hydroxy-N'-[(2S)-1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]-3-(2-methylpropyl)-2-(phenylsulfanylmethyl)butanediamide |
| SMILES | CNC(=O)[C@H](Cc1ccc(C)cc1)NC(=O)[C@H](CC(C)C)[C@H](CSc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C26H35N3O4S/c1-17(2)14-21(22(25(31)29-33)16-34-20-8-6-5-7-9-20)24(30)28-23(26(32)27-4)15-19-12-10-18(3)11-13-19/h5-13,17,21-23,33H,14-16H2,1-4H3,(H,27,32)(H,28,30)(H,29,31)/t21-,22+,23+/m1/s1 |
| InChIKey | HFQBVZYIJNPJPJ-VJBWXMMDSA-N |
| XLogP | 3.34 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|