C25H34N4O4S — CID 22723222
N-hydroxy-2-[[[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl-(2-methylpropyl)amino]methyl]-3-phenylsulfanylpropanamide (PubChem CID 22723222) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is N-hydroxy-2-[[[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl-(2-methylpropyl)amino]methyl]-3-phenylsulfanylpropanamide.
| Compound Name | N-hydroxy-2-[[[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl-(2-methylpropyl)amino]methyl]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 22723222 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-hydroxy-2-[[[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl-(2-methylpropyl)amino]methyl]-3-phenylsulfanylpropanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)NC(=O)N(CC(C)C)CC(CSc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C25H34N4O4S/c1-18(2)15-29(16-20(23(30)28-33)17-34-21-12-8-5-9-13-21)25(32)27-22(24(31)26-3)14-19-10-6-4-7-11-19/h4-13,18,20,22,33H,14-17H2,1-3H3,(H,26,31)(H,27,32)(H,28,30) |
| InChIKey | FFFBMOIYQFMHOS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|