C33H40N2O5 — CID 57220983
2-[[[(1S)-1-carboxy-2-(4-phenylphenyl)ethyl]carbamoyl-(2-methylpropyl)amino]methyl]-6-phenylhexanoic acid (PubChem CID 57220983) has the molecular formula C33H40N2O5 and a molecular weight of 544.69 g/mol. Its IUPAC name is 2-[[[(1S)-1-carboxy-2-(4-phenylphenyl)ethyl]carbamoyl-(2-methylpropyl)amino]methyl]-6-phenylhexanoic acid.
| Compound Name | 2-[[[(1S)-1-carboxy-2-(4-phenylphenyl)ethyl]carbamoyl-(2-methylpropyl)amino]methyl]-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 57220983 |
| Molecular Formula | C33H40N2O5 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 2-[[[(1S)-1-carboxy-2-(4-phenylphenyl)ethyl]carbamoyl-(2-methylpropyl)amino]methyl]-6-phenylhexanoic acid |
| SMILES | CC(C)CN(CC(CCCCc1ccccc1)C(=O)O)C(=O)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C33H40N2O5/c1-24(2)22-35(23-29(31(36)37)16-10-9-13-25-11-5-3-6-12-25)33(40)34-30(32(38)39)21-26-17-19-28(20-18-26)27-14-7-4-8-15-27/h3-8,11-12,14-15,17-20,24,29-30H,9-10,13,16,21-23H2,1-2H3,(H,34,40)(H,36,37)(H,38,39)/t29?,30-/m0/s1 |
| InChIKey | DTCFAKDICHJPIP-ZSXSBBPPSA-N |
| XLogP | 6.13 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|