C34H41N3O6 — CID 54349574
(2S)-2-[[[3-(2-acetamidoethoxy)-2-benzyl-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 54349574) has the molecular formula C34H41N3O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is (2S)-2-[[[3-(2-acetamidoethoxy)-2-benzyl-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[[3-(2-acetamidoethoxy)-2-benzyl-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 54349574 |
| Molecular Formula | C34H41N3O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | (2S)-2-[[[3-(2-acetamidoethoxy)-2-benzyl-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CC(=O)NCCOC(=O)C(Cc1ccccc1)CN(CC(C)C)C(=O)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C34H41N3O6/c1-24(2)22-37(23-30(20-26-10-6-4-7-11-26)33(41)43-19-18-35-25(3)38)34(42)36-31(32(39)40)21-27-14-16-29(17-15-27)28-12-8-5-9-13-28/h4-17,24,30-31H,18-23H2,1-3H3,(H,35,38)(H,36,42)(H,39,40)/t30?,31-/m0/s1 |
| InChIKey | UETRLEVLBLMGST-FLDQDSGZSA-N |
| XLogP | 4.56 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|