C35H44N2O6 — CID 54136627
(2S)-2-[[[2-(2-methoxyphenoxy)carbonyl-5-methylhexyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 54136627) has the molecular formula C35H44N2O6 and a molecular weight of 588.75 g/mol. Its IUPAC name is (2S)-2-[[[2-(2-methoxyphenoxy)carbonyl-5-methylhexyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[[2-(2-methoxyphenoxy)carbonyl-5-methylhexyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 54136627 |
| Molecular Formula | C35H44N2O6 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | (2S)-2-[[[2-(2-methoxyphenoxy)carbonyl-5-methylhexyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | COc1ccccc1OC(=O)C(CCC(C)C)CN(CC(C)C)C(=O)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C35H44N2O6/c1-24(2)15-18-29(34(40)43-32-14-10-9-13-31(32)42-5)23-37(22-25(3)4)35(41)36-30(33(38)39)21-26-16-19-28(20-17-26)27-11-7-6-8-12-27/h6-14,16-17,19-20,24-25,29-30H,15,18,21-23H2,1-5H3,(H,36,41)(H,38,39)/t29?,30-/m0/s1 |
| InChIKey | NYEAWGQGFFRHPR-ZSXSBBPPSA-N |
| XLogP | 6.68 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|