C42H50N2O6 — CID 67588802
(2S)-2-benzyl-2-[[[2-(2-methoxyphenoxy)carbonyl-5-methylhexyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 67588802) has the molecular formula C42H50N2O6 and a molecular weight of 678.87 g/mol. Its IUPAC name is (2S)-2-benzyl-2-[[[2-(2-methoxyphenoxy)carbonyl-5-methylhexyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-benzyl-2-[[[2-(2-methoxyphenoxy)carbonyl-5-methylhexyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 67588802 |
| Molecular Formula | C42H50N2O6 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | (2S)-2-benzyl-2-[[[2-(2-methoxyphenoxy)carbonyl-5-methylhexyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | COc1ccccc1OC(=O)C(CCC(C)C)CN(CC(C)C)C(=O)N[C@@](Cc1ccccc1)(Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C42H50N2O6/c1-30(2)20-23-36(39(45)50-38-19-13-12-18-37(38)49-5)29-44(28-31(3)4)41(48)43-42(40(46)47,26-32-14-8-6-9-15-32)27-33-21-24-35(25-22-33)34-16-10-7-11-17-34/h6-19,21-22,24-25,30-31,36H,20,23,26-29H2,1-5H3,(H,43,48)(H,46,47)/t36?,42-/m0/s1 |
| InChIKey | NIWRMQZCTRJADR-RSUXCQCMSA-N |
| XLogP | 8.30 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|