C41H47N3O6 — CID 67588569
(2S)-2-[[[3-(2-acetamidoethoxy)-2-benzyl-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-2-benzyl-3-(4-phenylphenyl)propanoic acid (PubChem CID 67588569) has the molecular formula C41H47N3O6 and a molecular weight of 677.84 g/mol. Its IUPAC name is (2S)-2-[[[3-(2-acetamidoethoxy)-2-benzyl-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-2-benzyl-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[[3-(2-acetamidoethoxy)-2-benzyl-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-2-benzyl-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 67588569 |
| Molecular Formula | C41H47N3O6 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.35 |
| IUPAC Name | (2S)-2-[[[3-(2-acetamidoethoxy)-2-benzyl-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-2-benzyl-3-(4-phenylphenyl)propanoic acid |
| SMILES | CC(=O)NCCOC(=O)C(Cc1ccccc1)CN(CC(C)C)C(=O)N[C@@](Cc1ccccc1)(Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C41H47N3O6/c1-30(2)28-44(29-37(25-32-13-7-4-8-14-32)38(46)50-24-23-42-31(3)45)40(49)43-41(39(47)48,26-33-15-9-5-10-16-33)27-34-19-21-36(22-20-34)35-17-11-6-12-18-35/h4-22,30,37H,23-29H2,1-3H3,(H,42,45)(H,43,49)(H,47,48)/t37?,41-/m0/s1 |
| InChIKey | IPGLTGQCQHCBKK-ZWHSRKQRSA-N |
| XLogP | 6.17 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|