C27H35N3O6 — CID 54248991
(2S)-2-[[[3-(2-acetamidoethoxy)-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 54248991) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is (2S)-2-[[[3-(2-acetamidoethoxy)-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[[3-(2-acetamidoethoxy)-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 54248991 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | (2S)-2-[[[3-(2-acetamidoethoxy)-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CC(=O)NCCOC(=O)CCN(CC(C)C)C(=O)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H35N3O6/c1-19(2)18-30(15-13-25(32)36-16-14-28-20(3)31)27(35)29-24(26(33)34)17-21-9-11-23(12-10-21)22-7-5-4-6-8-22/h4-12,19,24H,13-18H2,1-3H3,(H,28,31)(H,29,35)(H,33,34)/t24-/m0/s1 |
| InChIKey | QVJSDLXIXXIPTL-DEOSSOPVSA-N |
| XLogP | 3.09 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|