C26H33NO4S — CID 159750521
(2S,3R)-6-benzyl-N-hydroxy-3-(2-methylpropyl)-4,7-dioxo-2-(phenylsulfanylmethyl)octanamide (PubChem CID 159750521) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is (2S,3R)-6-benzyl-N-hydroxy-3-(2-methylpropyl)-4,7-dioxo-2-(phenylsulfanylmethyl)octanamide.
| Compound Name | (2S,3R)-6-benzyl-N-hydroxy-3-(2-methylpropyl)-4,7-dioxo-2-(phenylsulfanylmethyl)octanamide |
|---|---|
| PubChem CID | 159750521 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (2S,3R)-6-benzyl-N-hydroxy-3-(2-methylpropyl)-4,7-dioxo-2-(phenylsulfanylmethyl)octanamide |
| SMILES | CC(=O)C(CC(=O)[C@H](CC(C)C)[C@H](CSc1ccccc1)C(=O)NO)Cc1ccccc1 |
| InChI | InChI=1S/C26H33NO4S/c1-18(2)14-23(24(26(30)27-31)17-32-22-12-8-5-9-13-22)25(29)16-21(19(3)28)15-20-10-6-4-7-11-20/h4-13,18,21,23-24,31H,14-17H2,1-3H3,(H,27,30)/t21?,23-,24+/m1/s1 |
| InChIKey | ZSZUOMZGSKABHB-RSOKHERMSA-N |
| XLogP | 4.97 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|