(2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid

C16H23NO3 — CID 67477139

IUPAC(2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid
SMILESCC(C)C[C@H](N)C(=O)C[C@@H](Cc1ccccc1)C(=O)O
InChIInChI=1S/C16H23NO3/c1-11(2)8-14(17)15(18)10-13(16(19)20)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,17H2,1-2H3,(H,19,20)/t13-,14+/m1/s1
InChIKeySGMZGZICZKFASN-KGLIPLIRSA-N
MW277.36 g/mol
LogP2.26
Rot. Bonds8

About (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid

(2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid (PubChem CID 67477139) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid.

Molecular Properties

Compound Name(2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid
PubChem CID67477139
Molecular FormulaC16H23NO3
Molecular Weight277.36 g/mol
Exact Mass277.17
IUPAC Name(2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid
SMILESCC(C)C[C@H](N)C(=O)C[C@@H](Cc1ccccc1)C(=O)O
InChIInChI=1S/C16H23NO3/c1-11(2)8-14(17)15(18)10-13(16(19)20)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,17H2,1-2H3,(H,19,20)/t13-,14+/m1/s1
InChIKeySGMZGZICZKFASN-KGLIPLIRSA-N
XLogP2.26
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.36
LogP ≤ 52.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid?
The IUPAC name of (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid (CID 67477139) is (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid.
What is the SMILES notation for (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid?
The canonical SMILES for (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid is CC(C)C[C@H](N)C(=O)C[C@@H](Cc1ccccc1)C(=O)O.
What is the InChIKey of (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid?
The InChIKey is SGMZGZICZKFASN-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H23NO3/c1-11(2)8-14(17)15(18)10-13(16(19)20)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,17H2,1-2H3,(H,19,20)/t13-,14+/m1/s1.
What are the key properties of (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid?
(2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid has a molecular weight of 277.36 g/mol, XLogP of 2.26, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-5-amino-2-benzyl-7-methyl-4-oxooctanoic acid is sourced from PubChem (CID 67477139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).