C15H22N2O3 — CID 67828765
(2S)-2,7-diamino-4-methyl-6-oxo-8-phenyloctanoic acid (PubChem CID 67828765) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2S)-2,7-diamino-4-methyl-6-oxo-8-phenyloctanoic acid.
| Compound Name | (2S)-2,7-diamino-4-methyl-6-oxo-8-phenyloctanoic acid |
|---|---|
| PubChem CID | 67828765 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (2S)-2,7-diamino-4-methyl-6-oxo-8-phenyloctanoic acid |
| SMILES | CC(CC(=O)C(N)Cc1ccccc1)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H22N2O3/c1-10(7-13(17)15(19)20)8-14(18)12(16)9-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9,16-17H2,1H3,(H,19,20)/t10?,12?,13-/m0/s1 |
| InChIKey | BKYHGVCVWFVFOJ-GDKBPFBDSA-N |
| XLogP | 0.95 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |