C21H25NO4 — CID 175380066
(2S)-2-amino-6-(1,2-diphenylethoxy)-4-methyl-6-oxohexanoic acid (PubChem CID 175380066) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (2S)-2-amino-6-(1,2-diphenylethoxy)-4-methyl-6-oxohexanoic acid.
| Compound Name | (2S)-2-amino-6-(1,2-diphenylethoxy)-4-methyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 175380066 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (2S)-2-amino-6-(1,2-diphenylethoxy)-4-methyl-6-oxohexanoic acid |
| SMILES | CC(CC(=O)OC(Cc1ccccc1)c1ccccc1)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C21H25NO4/c1-15(12-18(22)21(24)25)13-20(23)26-19(17-10-6-3-7-11-17)14-16-8-4-2-5-9-16/h2-11,15,18-19H,12-14,22H2,1H3,(H,24,25)/t15?,18-,19?/m0/s1 |
| InChIKey | DYFSHYVTYOBMOA-OBONGRFPSA-N |
| XLogP | 3.34 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |