C18H29NO2 — CID 161370399
3-amino-5-methylhexan-2-one;3-methyl-4-phenylbutan-2-one (PubChem CID 161370399) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-amino-5-methylhexan-2-one;3-methyl-4-phenylbutan-2-one.
| Compound Name | 3-amino-5-methylhexan-2-one;3-methyl-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 161370399 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 3-amino-5-methylhexan-2-one;3-methyl-4-phenylbutan-2-one |
| SMILES | CC(=O)C(C)Cc1ccccc1.CC(=O)C(N)CC(C)C |
| InChI | InChI=1S/C11H14O.C7H15NO/c1-9(10(2)12)8-11-6-4-3-5-7-11;1-5(2)4-7(8)6(3)9/h3-7,9H,8H2,1-2H3;5,7H,4,8H2,1-3H3 |
| InChIKey | VQJRPKSTXBEZCM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |