C33H40N4O5S — CID 91930897
(2S,3R)-N-hydroxy-N'-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-(2-methylpropyl)-2-[[2-nitroso-2-(4-phenylphenyl)ethyl]sulfanylmethyl]butanediamide (PubChem CID 91930897) has the molecular formula C33H40N4O5S and a molecular weight of 604.77 g/mol. Its IUPAC name is (2S,3R)-N-hydroxy-N'-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-(2-methylpropyl)-2-[[2-nitroso-2-(4-phenylphenyl)ethyl]sulfanylmethyl]butanediamide.
| Compound Name | (2S,3R)-N-hydroxy-N'-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-(2-methylpropyl)-2-[[2-nitroso-2-(4-phenylphenyl)ethyl]sulfanylmethyl]butanediamide |
|---|---|
| PubChem CID | 91930897 |
| Molecular Formula | C33H40N4O5S |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | (2S,3R)-N-hydroxy-N'-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-3-(2-methylpropyl)-2-[[2-nitroso-2-(4-phenylphenyl)ethyl]sulfanylmethyl]butanediamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)[C@H](CSCC(N=O)c1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C33H40N4O5S/c1-22(2)18-27(31(38)35-29(33(40)34-3)19-23-10-6-4-7-11-23)28(32(39)37-42)20-43-21-30(36-41)26-16-14-25(15-17-26)24-12-8-5-9-13-24/h4-17,22,27-30,42H,18-21H2,1-3H3,(H,34,40)(H,35,38)(H,37,39)/t27-,28+,29+,30?/m1/s1 |
| InChIKey | VUOYXAHTJMIVRD-VRLMGCJKSA-N |
| XLogP | 5.15 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|