C27H32N4O9S — CID 58582917
[[(2S)-2-[[(2R)-2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]methanesulfonic acid (PubChem CID 58582917) has the molecular formula C27H32N4O9S and a molecular weight of 588.64 g/mol. Its IUPAC name is [[(2S)-2-[[(2R)-2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]methanesulfonic acid.
| Compound Name | [[(2S)-2-[[(2R)-2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 58582917 |
| Molecular Formula | C27H32N4O9S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | [[(2S)-2-[[(2R)-2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]methanesulfonic acid |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)NCS(=O)(=O)O)C(CN1C(=O)c2ccccc2C1=O)C(=O)NO |
| InChI | InChI=1S/C27H32N4O9S/c1-16(2)12-20(21(24(33)30-37)14-31-26(35)18-10-6-7-11-19(18)27(31)36)23(32)29-22(13-17-8-4-3-5-9-17)25(34)28-15-41(38,39)40/h3-11,16,20-22,37H,12-15H2,1-2H3,(H,28,34)(H,29,32)(H,30,33)(H,38,39,40)/t20-,21?,22+/m1/s1 |
| InChIKey | MHJRRLIIPJUYKO-QFMSAKRMSA-N |
| XLogP | 0.76 |
| TPSA | 199.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|