C28H33BrN4O5 — CID 70222259
(2S)-2-[[2-bromo-4-(1,3-dioxoisoindol-2-yl)butanoyl]amino]-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide (PubChem CID 70222259) has the molecular formula C28H33BrN4O5 and a molecular weight of 585.50 g/mol. Its IUPAC name is (2S)-2-[[2-bromo-4-(1,3-dioxoisoindol-2-yl)butanoyl]amino]-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[2-bromo-4-(1,3-dioxoisoindol-2-yl)butanoyl]amino]-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 70222259 |
| Molecular Formula | C28H33BrN4O5 |
| Molecular Weight | 585.50 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | (2S)-2-[[2-bromo-4-(1,3-dioxoisoindol-2-yl)butanoyl]amino]-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)C(Br)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H33BrN4O5/c1-17(2)15-22(26(36)32-23(25(35)30-3)16-18-9-5-4-6-10-18)31-24(34)21(29)13-14-33-27(37)19-11-7-8-12-20(19)28(33)38/h4-12,17,21-23H,13-16H2,1-3H3,(H,30,35)(H,31,34)(H,32,36)/t21?,22-,23-/m0/s1 |
| InChIKey | BMLWHLIKDQMDCN-KXNJDZORSA-N |
| XLogP | 2.44 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|