C32H42N4O10S — CID 10233543
5-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]pentane-1-sulfonic acid (PubChem CID 10233543) has the molecular formula C32H42N4O10S and a molecular weight of 674.77 g/mol. Its IUPAC name is 5-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]pentane-1-sulfonic acid.
| Compound Name | 5-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]pentane-1-sulfonic acid |
|---|---|
| PubChem CID | 10233543 |
| Molecular Formula | C32H42N4O10S |
| Molecular Weight | 674.77 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | 5-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]pentane-1-sulfonic acid |
| SMILES | CNC(=O)C(Cc1ccc(OCCCCCS(=O)(=O)O)cc1)NC(=O)C(CC(C)C)C(CN1C(=O)c2ccccc2C1=O)C(=O)NO |
| InChI | InChI=1S/C32H42N4O10S/c1-20(2)17-25(26(29(38)35-42)19-36-31(40)23-9-5-6-10-24(23)32(36)41)28(37)34-27(30(39)33-3)18-21-11-13-22(14-12-21)46-15-7-4-8-16-47(43,44)45/h5-6,9-14,20,25-27,42H,4,7-8,15-19H2,1-3H3,(H,33,39)(H,34,37)(H,35,38)(H,43,44,45) |
| InChIKey | HPDLFYHXIJMRDY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 208.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.77 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|