C19H29CsN2O7S — CID 23664366
cesium 4-[4-[(2S)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenoxy]butane-1-sulfonate (PubChem CID 23664366) has the molecular formula C19H29CsN2O7S and a molecular weight of 562.42 g/mol. Its IUPAC name is cesium 4-[4-[(2S)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenoxy]butane-1-sulfonate.
| Compound Name | cesium 4-[4-[(2S)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 23664366 |
| Molecular Formula | C19H29CsN2O7S |
| Molecular Weight | 562.42 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | cesium 4-[4-[(2S)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenoxy]butane-1-sulfonate |
| SMILES | CNC(=O)[C@H](Cc1ccc(OCCCCS(=O)(=O)[O-])cc1)NC(=O)OC(C)(C)C.[Cs+] |
| InChI | InChI=1S/C19H30N2O7S.Cs/c1-19(2,3)28-18(23)21-16(17(22)20-4)13-14-7-9-15(10-8-14)27-11-5-6-12-29(24,25)26;/h7-10,16H,5-6,11-13H2,1-4H3,(H,20,22)(H,21,23)(H,24,25,26);/q;+1/p-1/t16-;/m0./s1 |
| InChIKey | CLMDVJCKCVLKBU-NTISSMGPSA-M |
| XLogP | -1.42 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.42 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|