C16H24N2O7S — CID 100965849
[4-[(2S)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenoxy] methanesulfonate (PubChem CID 100965849) has the molecular formula C16H24N2O7S and a molecular weight of 388.44 g/mol. Its IUPAC name is [4-[(2S)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenoxy] methanesulfonate.
| Compound Name | [4-[(2S)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenoxy] methanesulfonate |
|---|---|
| PubChem CID | 100965849 |
| Molecular Formula | C16H24N2O7S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [4-[(2S)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenoxy] methanesulfonate |
| SMILES | CNC(=O)[C@H](Cc1ccc(OOS(C)(=O)=O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N2O7S/c1-16(2,3)23-15(20)18-13(14(19)17-4)10-11-6-8-12(9-7-11)24-25-26(5,21)22/h6-9,13H,10H2,1-5H3,(H,17,19)(H,18,20)/t13-/m0/s1 |
| InChIKey | CRRWOCGYGGZCOQ-ZDUSSCGKSA-N |
| XLogP | 1.14 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|