C31H40N4O10S — CID 10283184
4-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]butane-1-sulfonic acid (PubChem CID 10283184) has the molecular formula C31H40N4O10S and a molecular weight of 660.75 g/mol. Its IUPAC name is 4-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]butane-1-sulfonic acid.
| Compound Name | 4-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 10283184 |
| Molecular Formula | C31H40N4O10S |
| Molecular Weight | 660.75 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | 4-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]butane-1-sulfonic acid |
| SMILES | CNC(=O)C(Cc1ccc(OCCCCS(=O)(=O)O)cc1)NC(=O)C(CC(C)C)C(CN1C(=O)c2ccccc2C1=O)C(=O)NO |
| InChI | InChI=1S/C31H40N4O10S/c1-19(2)16-24(25(28(37)34-41)18-35-30(39)22-8-4-5-9-23(22)31(35)40)27(36)33-26(29(38)32-3)17-20-10-12-21(13-11-20)45-14-6-7-15-46(42,43)44/h4-5,8-13,19,24-26,41H,6-7,14-18H2,1-3H3,(H,32,38)(H,33,36)(H,34,37)(H,42,43,44) |
| InChIKey | VQGLNVCBAVVWJL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 208.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|