C30H37N3O6S — CID 89342881
2-[[(2S)-2-[[(2R)-2-[1-(hydroxyamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]ethanesulfinic acid (PubChem CID 89342881) has the molecular formula C30H37N3O6S and a molecular weight of 567.71 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2R)-2-[1-(hydroxyamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]ethanesulfinic acid.
| Compound Name | 2-[[(2S)-2-[[(2R)-2-[1-(hydroxyamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]ethanesulfinic acid |
|---|---|
| PubChem CID | 89342881 |
| Molecular Formula | C30H37N3O6S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 2-[[(2S)-2-[[(2R)-2-[1-(hydroxyamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]ethanesulfinic acid |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)NCCS(=O)O)C(Cc1ccc2ccccc2c1)C(=O)NO |
| InChI | InChI=1S/C30H37N3O6S/c1-20(2)16-25(26(29(35)33-37)18-22-12-13-23-10-6-7-11-24(23)17-22)28(34)32-27(19-21-8-4-3-5-9-21)30(36)31-14-15-40(38)39/h3-13,17,20,25-27,37H,14-16,18-19H2,1-2H3,(H,31,36)(H,32,34)(H,33,35)(H,38,39)/t25-,26?,27+/m1/s1 |
| InChIKey | QVGBTQJDSIGNTD-HXMJJLHYSA-N |
| XLogP | 3.23 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|