C32H33N2NaO8S — CID 23689050
sodium 4-[(2S)-3-(furan-2-yl)-2-[[(2S)-2-[1-(hydroxyamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-oxopropyl]benzenesulfonate (PubChem CID 23689050) has the molecular formula C32H33N2NaO8S and a molecular weight of 628.68 g/mol. Its IUPAC name is sodium 4-[(2S)-3-(furan-2-yl)-2-[[(2S)-2-[1-(hydroxyamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-oxopropyl]benzenesulfonate.
| Compound Name | sodium 4-[(2S)-3-(furan-2-yl)-2-[[(2S)-2-[1-(hydroxyamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-oxopropyl]benzenesulfonate |
|---|---|
| PubChem CID | 23689050 |
| Molecular Formula | C32H33N2NaO8S |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.19 |
| IUPAC Name | sodium 4-[(2S)-3-(furan-2-yl)-2-[[(2S)-2-[1-(hydroxyamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-oxopropyl]benzenesulfonate |
| SMILES | CC(C)C[C@H](C(=O)N[C@@H](Cc1ccc(S(=O)(=O)[O-])cc1)C(=O)c1ccco1)C(Cc1ccc2ccccc2c1)C(=O)NO.[Na+] |
| InChI | InChI=1S/C32H34N2O8S.Na/c1-20(2)16-26(27(32(37)34-38)18-22-9-12-23-6-3-4-7-24(23)17-22)31(36)33-28(30(35)29-8-5-15-42-29)19-21-10-13-25(14-11-21)43(39,40)41;/h3-15,17,20,26-28,38H,16,18-19H2,1-2H3,(H,33,36)(H,34,37)(H,39,40,41);/q;+1/p-1/t26-,27?,28-;/m0./s1 |
| InChIKey | WOGZBIVKEFWFDF-PBZYEBSDSA-M |
| XLogP | 1.28 |
| TPSA | 165.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|