C25H27N3O5 — CID 175148604
(2S)-N-[(2S)-1-(furan-2-yl)-4-methyl-1-oxopentan-2-yl]-2-(3-nitroanilino)-3-phenylpropanamide (PubChem CID 175148604) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(furan-2-yl)-4-methyl-1-oxopentan-2-yl]-2-(3-nitroanilino)-3-phenylpropanamide.
| Compound Name | (2S)-N-[(2S)-1-(furan-2-yl)-4-methyl-1-oxopentan-2-yl]-2-(3-nitroanilino)-3-phenylpropanamide |
|---|---|
| PubChem CID | 175148604 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (2S)-N-[(2S)-1-(furan-2-yl)-4-methyl-1-oxopentan-2-yl]-2-(3-nitroanilino)-3-phenylpropanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)Nc1cccc([N+](=O)[O-])c1)C(=O)c1ccco1 |
| InChI | InChI=1S/C25H27N3O5/c1-17(2)14-21(24(29)23-12-7-13-33-23)27-25(30)22(15-18-8-4-3-5-9-18)26-19-10-6-11-20(16-19)28(31)32/h3-13,16-17,21-22,26H,14-15H2,1-2H3,(H,27,30)/t21-,22-/m0/s1 |
| InChIKey | DNOQNUZPKJDIGK-VXKWHMMOSA-N |
| XLogP | 4.62 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|