C29H32N4O5S — CID 91930899
(2R,3S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-2-benzyl-N'-hydroxy-3-[(2-nitroso-2-phenylethyl)sulfanylmethyl]butanediamide (PubChem CID 91930899) has the molecular formula C29H32N4O5S and a molecular weight of 548.67 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-2-benzyl-N'-hydroxy-3-[(2-nitroso-2-phenylethyl)sulfanylmethyl]butanediamide.
| Compound Name | (2R,3S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-2-benzyl-N'-hydroxy-3-[(2-nitroso-2-phenylethyl)sulfanylmethyl]butanediamide |
|---|---|
| PubChem CID | 91930899 |
| Molecular Formula | C29H32N4O5S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (2R,3S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-2-benzyl-N'-hydroxy-3-[(2-nitroso-2-phenylethyl)sulfanylmethyl]butanediamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)[C@H](CSCC(N=O)c1ccccc1)C(=O)NO |
| InChI | InChI=1S/C29H32N4O5S/c30-27(34)25(17-21-12-6-2-7-13-21)31-28(35)23(16-20-10-4-1-5-11-20)24(29(36)33-38)18-39-19-26(32-37)22-14-8-3-9-15-22/h1-15,23-26,38H,16-19H2,(H2,30,34)(H,31,35)(H,33,36)/t23-,24+,25+,26?/m1/s1 |
| InChIKey | XKLHIUFAZLMKCL-VHNWMKGBSA-N |
| XLogP | 3.42 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|